000 | 01631 a2200445 4500 | ||
---|---|---|---|
005 | 20250514024416.0 | ||
264 | 0 | _c20020405 | |
008 | 200204s 0 0 eng d | ||
022 | _a0364-2313 | ||
024 | 7 |
_a10.1007/s00268-001-0233-y _2doi |
|
040 |
_aNLM _beng _cNLM |
||
100 | 1 | _aOgura, Yoshifumi | |
245 | 0 | 0 |
_aInhibitory effect of loxiglumide (CR 1505), a cholecystokinin receptor antagonist, on N-nitrosobis(2-oxopropyl) amine-induced biliary carcinogenesis in Syrian hamsters. _h[electronic resource] |
260 |
_bWorld journal of surgery _cMar 2002 |
||
300 |
_a359-65 p. _bdigital |
||
500 | _aPublication Type: Journal Article | ||
650 | 0 | 4 |
_aAdenocarcinoma, Papillary _xchemically induced |
650 | 0 | 4 | _aAnimals |
650 | 0 | 4 | _aAutoradiography |
650 | 0 | 4 |
_aBiliary Tract Neoplasms _xchemically induced |
650 | 0 | 4 |
_aCarcinogens _xadverse effects |
650 | 0 | 4 | _aCholecystectomy, Laparoscopic |
650 | 0 | 4 | _aCricetinae |
650 | 0 | 4 | _aDisease Models, Animal |
650 | 0 | 4 | _aDuodenostomy |
650 | 0 | 4 | _aFemale |
650 | 0 | 4 |
_aHormone Antagonists _xpharmacology |
650 | 0 | 4 | _aMesocricetus |
650 | 0 | 4 |
_aNitrosamines _xadverse effects |
650 | 0 | 4 |
_aProglumide _xanalogs & derivatives |
650 | 0 | 4 | _aRadiography |
650 | 0 | 4 |
_aReceptors, Cholecystokinin _xantagonists & inhibitors |
700 | 1 | _aMatsuda, Shinsuke | |
700 | 1 | _aItho, Morihiro | |
700 | 1 | _aSasaki, Hideto | |
700 | 1 | _aTanigawa, Kanji | |
700 | 1 | _aShimomura, Makoto | |
773 | 0 |
_tWorld journal of surgery _gvol. 26 _gno. 3 _gp. 359-65 |
|
856 | 4 | 0 |
_uhttps://doi.org/10.1007/s00268-001-0233-y _zAvailable from publisher's website |
999 |
_c11773130 _d11773130 |