| 000 | 01057 a2200205 4500 | ||
|---|---|---|---|
| 005 | 20250514014316.0 | ||
| 008 | ####s 0 0 eng d | ||
| 022 | _a1520-510X | ||
| 024 | 7 |
_a10.1021/ic961199c _2doi |
|
| 040 |
_aNLM _beng _cNLM |
||
| 100 | 1 | _aJones, Peter G. | |
| 245 | 0 | 0 |
_aOrganometallic Selenolates. 5.(1) Synthesis and Complexing Properties of 2-Propene- and 2-Methyl-2-propeneselenolato Molybdenum and Tungsten Compounds. Crystal Structures of cp(CO)(3)WSeCH(2)C(CH(3))=CH(2), [cp(CO)(2)MoSeCH(2)C(CH(3))=CH(2)](2), [cp(CO)(3)Mo(&mgr;-SeCH(2)C(CH(3))=CH(2))W(CO)(5)], [cp(CO)(3)Mo(&mgr;-SeCH(2)C(CH(3))=CH(2))Mo(CO)(5)], and [cp(CO)(3)Mo(&mgr;-SeCH(2)CH=CH(2))Mo(CO)(5)]. _h[electronic resource] |
| 260 |
_bInorganic chemistry _cMay 1997 |
||
| 300 |
_a2097-2102 p. _bdigital |
||
| 500 | _aPublication Type: Journal Article | ||
| 700 | 1 | _aLaube, Jörg | |
| 700 | 1 | _aThöne, Carsten | |
| 773 | 0 |
_tInorganic chemistry _gvol. 36 _gno. 10 _gp. 2097-2102 |
|
| 856 | 4 | 0 |
_uhttps://doi.org/10.1021/ic961199c _zAvailable from publisher's website |
| 999 |
_c11587181 _d11587181 |
||